 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(SCC(NC(OC(C)(C)C)=O)C(=O)[O-])CC(NC(OC(C)(C)C)=O)C(=O)[O-] |
| InChI: | InChI=1/C16H28N2O8S2/c1-15(2,3)25-13(23)17-9(11(19)20)7-27-28-8-10(12(21)22)18-14(24)26-16(4,5)6/h9-10H,7-8H2,1-6H3,(H,17,23)(H,18,24)(H,19,20)(H,21,22)/p-2/t9-,10+ |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=26.2385 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 438.522 g/mol | logS: -4.66084 | SlogP: -0.3458 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0892536 | Sterimol/B1: 3.27289 | Sterimol/B2: 3.80247 | Sterimol/B3: 4.08038 | |||
| Sterimol/B4: 9.35688 | Sterimol/L: 15.3958 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 692.267 | Positive charged surface: 407.256 | Negative charged surface: 285.011 | Volume: 390.25 | |||
| Hydrophobic surface: 334.952 | Hydrophilic surface: 357.315 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
