Type: Neutral
Formula: C10H12N4O5
SMILES: |
O1C(CO)C(O)C(O)C1n1ncc2c1N=CNC2=O |
InChI: |
InChI=1/C10H12N4O5/c15-2-5-6(16)7(17)10(19-5)14-8-4(1-13-14)9(18)12-3-11-8/h1,3,5-7,10,15-17H,2H2,(H,11,12,18)/t5-,6+,7-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.229 g/mol | logS: -0.29363 | SlogP: -2.0067 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.112451 | Sterimol/B1: 2.32479 | Sterimol/B2: 2.36892 | Sterimol/B3: 4.67489 |
Sterimol/B4: 6.21535 | Sterimol/L: 13.3057 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 458.872 | Positive charged surface: 326.42 | Negative charged surface: 132.451 | Volume: 219.375 |
Hydrophobic surface: 179.188 | Hydrophilic surface: 279.684 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|