Type: Neutral
Formula: C12H17N5O3S
SMILES: |
S(CC)C1C(O)C(OC1CO)n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C12H17N5O3S/c1-2-21-9-6(3-18)20-12(8(9)19)17-5-16-7-10(13)14-4-15-11(7)17/h4-6,8-9,12,18-19H,2-3H2,1H3,(H2,13,14,15)/t6-,8-,9-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 311.366 g/mol | logS: -2.48431 | SlogP: -0.1237 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0939345 | Sterimol/B1: 2.46406 | Sterimol/B2: 3.17354 | Sterimol/B3: 5.01586 |
Sterimol/B4: 6.94639 | Sterimol/L: 16.513 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 527.38 | Positive charged surface: 393.366 | Negative charged surface: 134.015 | Volume: 274.25 |
Hydrophobic surface: 230.393 | Hydrophilic surface: 296.987 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |