Type: Neutral
Formula: C11H15N5O5
SMILES: |
O1C(C(O)CO)C(O)C(O)C1n1c2ncnc(N)c2nc1 |
InChI: |
InChI=1/C11H15N5O5/c12-9-5-10(14-2-13-9)16(3-15-5)11-7(20)6(19)8(21-11)4(18)1-17/h2-4,6-8,11,17-20H,1H2,(H2,12,13,14)/t4-,6+,7+,8+,11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 297.271 g/mol | logS: -0.76014 | SlogP: -2.5236 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0810554 | Sterimol/B1: 2.46578 | Sterimol/B2: 3.24813 | Sterimol/B3: 4.38831 |
Sterimol/B4: 5.34152 | Sterimol/L: 14.095 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 478.713 | Positive charged surface: 380.149 | Negative charged surface: 98.5636 | Volume: 246 |
Hydrophobic surface: 159.313 | Hydrophilic surface: 319.4 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |