 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(=O)(=O)(NC(=O)c1ncn(C2OC(CO)C(O)C2[O-])c1N)c1ccc(cc1)C |
| InChI: | InChI=1/C16H19N4O7S/c1-8-2-4-9(5-3-8)28(25,26)19-15(24)11-14(17)20(7-18-11)16-13(23)12(22)10(6-21)27-16/h2-5,7,10,12-13,16,21-22H,6,17H2,1H3,(H,19,24)/q-1/t10-,12+,13-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=27.3846 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 411.415 g/mol | logS: -2.37128 | SlogP: -0.96238 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.112416 | Sterimol/B1: 2.14663 | Sterimol/B2: 4.20623 | Sterimol/B3: 4.94318 | |||
| Sterimol/B4: 8.05156 | Sterimol/L: 16.6913 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 625.453 | Positive charged surface: 366.479 | Negative charged surface: 258.974 | Volume: 342 | |||
| Hydrophobic surface: 367.954 | Hydrophilic surface: 257.499 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
