Type: Neutral
Formula: C11H16N6O4
SMILES: |
O1C(C(O)C)C(O)C(O)C1n1c2nc(nc(N)c2nc1)N |
InChI: |
InChI=1/C11H16N6O4/c1-3(18)7-5(19)6(20)10(21-7)17-2-14-4-8(12)15-11(13)16-9(4)17/h2-3,5-7,10,18-20H,1H3,(H4,12,13,15,16)/t3-,5-,6+,7+,10-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 296.287 g/mol | logS: -1.61251 | SlogP: -1.9138 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.10793 | Sterimol/B1: 2.43737 | Sterimol/B2: 3.40216 | Sterimol/B3: 5.25767 |
Sterimol/B4: 5.32405 | Sterimol/L: 13.954 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 486.817 | Positive charged surface: 373.75 | Negative charged surface: 113.067 | Volume: 251.125 |
Hydrophobic surface: 152.217 | Hydrophilic surface: 334.6 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 5 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |