 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C1NC(C(O)=O)C(CCCCC)C1c1ccccc1 |
| InChI: | InChI=1/C16H21NO3/c1-2-3-5-10-12-13(11-8-6-4-7-9-11)15(18)17-14(12)16(19)20/h4,6-9,12-14H,2-3,5,10H2,1H3,(H,17,18)(H,19,20)/t12-,13+,14+/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=84.6879 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 275.348 g/mol | logS: -4.07614 | SlogP: 2.5497 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.152659 | Sterimol/B1: 3.44495 | Sterimol/B2: 3.50114 | Sterimol/B3: 3.91739 | |||
| Sterimol/B4: 6.89792 | Sterimol/L: 12.6811 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 504.099 | Positive charged surface: 329.293 | Negative charged surface: 174.807 | Volume: 272.625 | |||
| Hydrophobic surface: 345.781 | Hydrophilic surface: 158.318 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
