 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(SCC(NC(=O)Cc1ccccc1)C(=O)[O-])CC(NC(=O)Cc1ccccc1)C(=O)[O-] |
| InChI: | InChI=1/C22H24N2O6S2/c25-19(11-15-7-3-1-4-8-15)23-17(21(27)28)13-31-32-14-18(22(29)30)24-20(26)12-16-9-5-2-6-10-16/h1-10,17-18H,11-14H2,(H,23,25)(H,24,26)(H,27,28)(H,29,30)/p-2/t17-,18-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=88.2444 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 474.558 g/mol | logS: -6.20268 | SlogP: -0.67746 | Reactive groups: 1 | |||
| Topological Properties | ||||||
| Globularity: 0.0300662 | Sterimol/B1: 2.82209 | Sterimol/B2: 3.14825 | Sterimol/B3: 4.24708 | |||
| Sterimol/B4: 9.16209 | Sterimol/L: 20.9021 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 784.338 | Positive charged surface: 397.338 | Negative charged surface: 387 | Volume: 429 | |||
| Hydrophobic surface: 512.243 | Hydrophilic surface: 272.095 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 4 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
