 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C(=O)CC(=O)NC2=O)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C9H13N2O10P/c12-4-1-5(13)11(9(16)10-4)8-7(15)6(14)3(21-8)2-20-22(17,18)19/h3,6-8,14-15H,1-2H2,(H,10,12,16)(H2,17,18,19)/p-2/t3-,6+,7-,8-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-14.9801 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 338.165 g/mol | logS: 0.20107 | SlogP: -5.3233 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.129843 | Sterimol/B1: 2.39299 | Sterimol/B2: 3.46663 | Sterimol/B3: 4.58015 | |||
| Sterimol/B4: 6.93481 | Sterimol/L: 14.385 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 480.446 | Positive charged surface: 222.853 | Negative charged surface: 257.593 | Volume: 237.875 | |||
| Hydrophobic surface: 126.137 | Hydrophilic surface: 354.309 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 7 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
