 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(N2C=CC(=NC2=O)N)C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C9H14N3O8P/c10-5-1-2-12(9(15)11-5)8-7(14)6(13)4(20-8)3-19-21(16,17)18/h1-2,4,6-8,13-14H,3H2,(H2,10,11,15)(H2,16,17,18)/p-2/t4-,6+,7+,8+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=7.73089 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 321.182 g/mol | logS: -0.00303 | SlogP: -4.4853 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0697031 | Sterimol/B1: 3.13743 | Sterimol/B2: 3.63931 | Sterimol/B3: 3.84575 | |||
| Sterimol/B4: 5.98781 | Sterimol/L: 15.1109 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 475.073 | Positive charged surface: 239.789 | Negative charged surface: 235.284 | Volume: 241.375 | |||
| Hydrophobic surface: 132.994 | Hydrophilic surface: 342.079 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 3 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 0 | ||||
|
