 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | P(OCC1OC(NC(=O)C[NH3+])C(O)C1O)(=O)([O-])[O-] |
| InChI: | InChI=1/C7H15N2O8P/c8-1-4(10)9-7-6(12)5(11)3(17-7)2-16-18(13,14)15/h3,5-7,11-12H,1-2,8H2,(H,9,10)(H2,13,14,15)/p-1/t3-,5-,6-,7+/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-6.4564 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 285.169 g/mol | logS: 1.07471 | SlogP: -6.4337 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.151675 | Sterimol/B1: 2.48758 | Sterimol/B2: 4.0077 | Sterimol/B3: 4.93387 | |||
| Sterimol/B4: 5.01131 | Sterimol/L: 13.0924 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 439.42 | Positive charged surface: 266.365 | Negative charged surface: 173.055 | Volume: 212.625 | |||
| Hydrophobic surface: 133.931 | Hydrophilic surface: 305.489 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 3 | Basic groups: 1 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | ||||
|
