Type: Neutral
Formula: C9H12N2O5S
SMILES: |
S1C(CO)C(O)C(O)C1N1C=CC(=O)NC1=O |
InChI: |
InChI=1/C9H12N2O5S/c12-3-4-6(14)7(15)8(17-4)11-2-1-5(13)10-9(11)16/h1-2,4,6-8,12,14-15H,3H2,(H,10,13,16)/t4-,6+,7-,8-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.27 g/mol | logS: -0.72089 | SlogP: -1.7925 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.128572 | Sterimol/B1: 3.16381 | Sterimol/B2: 3.60971 | Sterimol/B3: 4.03093 |
Sterimol/B4: 4.08838 | Sterimol/L: 13.4762 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 420.204 | Positive charged surface: 258.763 | Negative charged surface: 161.441 | Volume: 207 |
Hydrophobic surface: 166.852 | Hydrophilic surface: 253.352 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |