Type: Neutral
Formula: C10H14N2O5S
SMILES: |
S1C(CO)C(O)C(O)C1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C10H14N2O5S/c1-4-2-12(10(17)11-8(4)16)9-7(15)6(14)5(3-13)18-9/h2,5-7,9,13-15H,3H2,1H3,(H,11,16,17)/t5-,6+,7-,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 274.297 g/mol | logS: -0.73784 | SlogP: -1.4024 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.148575 | Sterimol/B1: 1.969 | Sterimol/B2: 3.61957 | Sterimol/B3: 4.3807 |
Sterimol/B4: 7.01615 | Sterimol/L: 12.42 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 437.219 | Positive charged surface: 270.296 | Negative charged surface: 166.923 | Volume: 224.25 |
Hydrophobic surface: 170.858 | Hydrophilic surface: 266.361 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |