Type: Neutral
Formula: C5H10N2O7P2
SMILES: |
P(O)(O)(=O)C(P(O)(O)=O)(O)Cn1ccnc1 |
InChI: |
InChI=1/C5H10N2O7P2/c8-5(15(9,10)11,16(12,13)14)3-7-2-1-6-4-7/h1-2,4,8H,3H2,(H2,9,10,11)(H2,12,13,14) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 272.09 g/mol | logS: 1.54655 | SlogP: -2.9894 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.220011 | Sterimol/B1: 2.90884 | Sterimol/B2: 3.81075 | Sterimol/B3: 3.96192 |
Sterimol/B4: 4.98303 | Sterimol/L: 11.1551 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 391.419 | Positive charged surface: 231.198 | Negative charged surface: 160.221 | Volume: 192.125 |
Hydrophobic surface: 120.728 | Hydrophilic surface: 270.691 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |