 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O=C(NC(C(CC)C)C(=O)[O-])C([NH3+])CCCNC(=[NH2+])N |
| InChI: | InChI=1/C12H25N5O3/c1-3-7(2)9(11(19)20)17-10(18)8(13)5-4-6-16-12(14)15/h7-9H,3-6,13H2,1-2H3,(H,17,18)(H,19,20)(H4,14,15,16)/p+1/t7-,8-,9-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-33.2661 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 288.372 g/mol | logS: -1.63203 | SlogP: -4.6787 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0413324 | Sterimol/B1: 3.36233 | Sterimol/B2: 3.57842 | Sterimol/B3: 4.02482 | |||
| Sterimol/B4: 5.50918 | Sterimol/L: 18.4943 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 575.239 | Positive charged surface: 434.971 | Negative charged surface: 140.268 | Volume: 287.75 | |||
| Hydrophobic surface: 230.072 | Hydrophilic surface: 345.167 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 1 | Hydrogen bond acceptors: 1 | Acid groups: 2 | Basic groups: 4 | |||
| Chiral centers: 3 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
