Type: Neutral
Formula: C12H16N2O5
SMILES: |
O1C(CO)C(O)CC1N1C=C(CC=C)C(=O)NC1=O |
InChI: |
InChI=1/C12H16N2O5/c1-2-3-7-5-14(12(18)13-11(7)17)10-4-8(16)9(6-15)19-10/h2,5,8-10,15-16H,1,3-4,6H2,(H,13,17,18)/t8-,9+,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.269 g/mol | logS: -1.2906 | SlogP: -0.5336 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0605663 | Sterimol/B1: 2.89003 | Sterimol/B2: 3.39238 | Sterimol/B3: 3.88401 |
Sterimol/B4: 6.33188 | Sterimol/L: 13.729 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 486.394 | Positive charged surface: 329.166 | Negative charged surface: 157.228 | Volume: 239.625 |
Hydrophobic surface: 229.872 | Hydrophilic surface: 256.522 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |