 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(C(c1ccccc1)c1ccccc1)CC(NC(=O)C(NC(=O)c1ccccc1)C)C(=O)[O-] |
| InChI: | InChI=1/C26H26N2O4S/c1-18(27-25(30)21-15-9-4-10-16-21)24(29)28-22(26(31)32)17-33-23(19-11-5-2-6-12-19)20-13-7-3-8-14-20/h2-16,18,22-23H,17H2,1H3,(H,27,30)(H,28,29)(H,31,32)/p-1/t18-,22-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=105.517 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 461.562 g/mol | logS: -6.81476 | SlogP: 2.6579 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.157595 | Sterimol/B1: 3.45127 | Sterimol/B2: 4.2502 | Sterimol/B3: 5.80321 | |||
| Sterimol/B4: 10.5897 | Sterimol/L: 17.341 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 795.423 | Positive charged surface: 416.157 | Negative charged surface: 379.265 | Volume: 447.875 | |||
| Hydrophobic surface: 616.206 | Hydrophilic surface: 179.217 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 2 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
