Type: Neutral
Formula: C8H14NO8P
SMILES: |
P(OCC)(O)(=O)CC(=O)NC(CC(O)=O)C(O)=O |
InChI: |
InChI=1/C8H14NO8P/c1-2-17-18(15,16)4-6(10)9-5(8(13)14)3-7(11)12/h5H,2-4H2,1H3,(H,9,10)(H,11,12)(H,13,14)(H,15,16)/t5-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 283.173 g/mol | logS: 0.36042 | SlogP: -1.8178 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0493391 | Sterimol/B1: 2.55235 | Sterimol/B2: 4.0747 | Sterimol/B3: 4.10497 |
Sterimol/B4: 5.52185 | Sterimol/L: 14.9312 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 485.887 | Positive charged surface: 300.117 | Negative charged surface: 185.77 | Volume: 225.875 |
Hydrophobic surface: 192.287 | Hydrophilic surface: 293.6 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 7 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules
|