Type: Neutral
Formula: C12H16N2O4
SMILES: |
OC1CC(N2C=C(C)C(=O)NC2=O)C2CC12CO |
InChI: |
InChI=1/C12H16N2O4/c1-6-4-14(11(18)13-10(6)17)8-2-9(16)12(5-15)3-7(8)12/h4,7-9,15-16H,2-3,5H2,1H3,(H,13,17,18)/t7-,8-,9-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 252.27 g/mol | logS: -0.64737 | SlogP: -0.4262 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.133379 | Sterimol/B1: 2.14221 | Sterimol/B2: 3.00101 | Sterimol/B3: 4.02321 |
Sterimol/B4: 6.50272 | Sterimol/L: 13.6357 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 449.871 | Positive charged surface: 304.111 | Negative charged surface: 145.76 | Volume: 228.375 |
Hydrophobic surface: 222.487 | Hydrophilic surface: 227.384 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |