Type: Neutral
Formula: C14H21N3O4
SMILES: |
O=C1NC(=O)NC(C)=C1\C=C\C(=O)NC(CC(C)C)CO |
InChI: |
InChI=1/C14H21N3O4/c1-8(2)6-10(7-18)16-12(19)5-4-11-9(3)15-14(21)17-13(11)20/h4-5,8,10,18H,6-7H2,1-3H3,(H,16,19)(H2,15,17,20,21)/b5-4+/t10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 295.339 g/mol | logS: -2.76407 | SlogP: 0.1792 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.112752 | Sterimol/B1: 2.62228 | Sterimol/B2: 3.00676 | Sterimol/B3: 5.88537 |
Sterimol/B4: 5.91701 | Sterimol/L: 15.725 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 551.087 | Positive charged surface: 360.169 | Negative charged surface: 190.918 | Volume: 278.375 |
Hydrophobic surface: 286.985 | Hydrophilic surface: 264.102 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |