Type: Neutral
Formula: C8H12N4O6
SMILES: |
O1C(CO)C(O)C(O)C1N1N=C/C(/NC1=O)=N\O |
InChI: |
InChI=1/C8H12N4O6/c13-2-3-5(14)6(15)7(18-3)12-8(16)10-4(11-17)1-9-12/h1,3,5-7,13-15,17H,2H2,(H,10,11,16)/t3-,5-,6+,7+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 260.206 g/mol | logS: 0.34646 | SlogP: -2.7759 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.14907 | Sterimol/B1: 2.51316 | Sterimol/B2: 4.4278 | Sterimol/B3: 5.12423 |
Sterimol/B4: 5.53142 | Sterimol/L: 13.1583 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 440.219 | Positive charged surface: 303.338 | Negative charged surface: 136.882 | Volume: 205.875 |
Hydrophobic surface: 105.855 | Hydrophilic surface: 334.364 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |