Type: Neutral
Formula: C19H24N4O5
SMILES: |
O(C(C)(C)C)C(=O)C(NC(=O)C(NC(=O)c1nc2c(nc1)cccc2)CO)C |
InChI: |
InChI=1/C19H24N4O5/c1-11(18(27)28-19(2,3)4)21-17(26)15(10-24)23-16(25)14-9-20-12-7-5-6-8-13(12)22-14/h5-9,11,15,24H,10H2,1-4H3,(H,21,26)(H,23,25)/t11-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.424 g/mol | logS: -2.67017 | SlogP: 0.5669 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0572495 | Sterimol/B1: 2.79 | Sterimol/B2: 3.80953 | Sterimol/B3: 5.56644 |
Sterimol/B4: 6.04239 | Sterimol/L: 20.6832 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 684.068 | Positive charged surface: 454.502 | Negative charged surface: 229.566 | Volume: 364.75 |
Hydrophobic surface: 438.192 | Hydrophilic surface: 245.876 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |