 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(OCC1OC(n2c3N=C(NC(=O)c3nc2)N)C([O-])C1O)(=O)(=O)c1ccc(cc1) C |
| InChI: | InChI=1/C17H18N5O7S/c1-8-2-4-9(5-3-8)30(26,27)28-6-10-12(23)13(24)16(29-10)22-7-19-11-14(22)20-17(18)21-15(11)25/h2-5,7,10,12-13,16,23H,6H2,1H3,(H3,18,20,21,25)/q-1/t10-,12-,13-,16-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=41.4989 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 436.425 g/mol | logS: -3.60323 | SlogP: -0.56048 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0532722 | Sterimol/B1: 2.67946 | Sterimol/B2: 3.3614 | Sterimol/B3: 5.11404 | |||
| Sterimol/B4: 6.56643 | Sterimol/L: 19.0965 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 663.061 | Positive charged surface: 360.321 | Negative charged surface: 302.74 | Volume: 357.75 | |||
| Hydrophobic surface: 321.475 | Hydrophilic surface: 341.586 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 8 | Acid groups: 1 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
