Type: Neutral
Formula: C19H26N4O
SMILES: |
O=C1N=C(NC2CCCCC2)C2(N1c1ccccc1)CCNCC2 |
InChI: |
InChI=1/C19H26N4O/c24-18-22-17(21-15-7-3-1-4-8-15)19(11-13-20-14-12-19)23(18)16-9-5-2-6-10-16/h2,5-6,9-10,15,20H,1,3-4,7-8,11-14H2,(H,21,22,24) |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 326.444 g/mol | logS: -3.74358 | SlogP: 3.0696 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0748053 | Sterimol/B1: 3.54897 | Sterimol/B2: 3.6266 | Sterimol/B3: 3.96121 |
Sterimol/B4: 5.62246 | Sterimol/L: 16.6861 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 550.332 | Positive charged surface: 398.917 | Negative charged surface: 151.415 | Volume: 318.625 |
Hydrophobic surface: 468.776 | Hydrophilic surface: 81.556 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |