 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | O(Cc1ccccc1)C(=O)N1CCCC1C(=O)NC(C(C)C)C(=O)NN |
| InChI: | InChI=1/C18H26N4O4/c1-12(2)15(17(24)21-19)20-16(23)14-9-6-10-22(14)18(25)26-11-13-7-4-3-5-8-13/h3-5,7-8,12,14-15H,6,9-11,19H2,1-2H3,(H,20,23)(H,21,24)/t14-,15-/m1/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=96.8434 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 362.43 g/mol | logS: -3.21603 | SlogP: 1.1847 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0703067 | Sterimol/B1: 1.969 | Sterimol/B2: 2.94621 | Sterimol/B3: 5.75064 | |||
| Sterimol/B4: 7.93883 | Sterimol/L: 19.3081 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 655.92 | Positive charged surface: 450.162 | Negative charged surface: 205.758 | Volume: 350.5 | |||
| Hydrophobic surface: 457.546 | Hydrophilic surface: 198.374 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.