Type: Neutral
Formula: C18H19N5O
SMILES: |
O(C)c1ccc(cc1)C1CCc2c3c(nc(nc3N)N)ncc2C1 |
InChI: |
InChI=1/C18H19N5O/c1-24-13-5-2-10(3-6-13)11-4-7-14-12(8-11)9-21-17-15(14)16(19)22-18(20)23-17/h2-3,5-6,9,11H,4,7-8H2,1H3,(H4,19,20,21,22,23)/t11-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 321.384 g/mol | logS: -5.58343 | SlogP: 2.47024 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0543704 | Sterimol/B1: 2.22407 | Sterimol/B2: 4.42958 | Sterimol/B3: 4.62382 |
Sterimol/B4: 5.13053 | Sterimol/L: 18.8717 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 551.992 | Positive charged surface: 403.526 | Negative charged surface: 143.275 | Volume: 303.625 |
Hydrophobic surface: 350.275 | Hydrophilic surface: 201.717 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 1 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |