Type: Ionized
Formula: C6H5O8-3
SMILES: |
OC(C(O)C(=O)[O-])(CC(=O)[O-])C(=O)[O-] |
InChI: |
InChI=1/C6H8O8/c7-2(8)1-6(14,5(12)13)3(9)4(10)11/h3,9,14H,1H2,(H,7,8)(H,10,11)(H,12,13)/p-3/t3-,6+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 205.098 g/mol | logS: 0.16375 | SlogP: -6.2818 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.314992 | Sterimol/B1: 2.55959 | Sterimol/B2: 3.25891 | Sterimol/B3: 3.78085 |
Sterimol/B4: 4.83618 | Sterimol/L: 10.4951 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 324.979 | Positive charged surface: 103.126 | Negative charged surface: 221.852 | Volume: 145.25 |
Hydrophobic surface: 44.7935 | Hydrophilic surface: 280.1855 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 2 | Acid groups: 6 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Parent related molecule:
|