Type: Neutral
Formula: C11H13F3N2O4
SMILES: |
FC(F)(F)C1(OC(N2C=C(C)C(=O)NC2=O)CC1)CO |
InChI: |
InChI=1/C11H13F3N2O4/c1-6-4-16(9(19)15-8(6)18)7-2-3-10(5-17,20-7)11(12,13)14/h4,7,17H,2-3,5H2,1H3,(H,15,18,19)/t7-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 294.229 g/mol | logS: -1.78021 | SlogP: 1.2918 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.130028 | Sterimol/B1: 2.13538 | Sterimol/B2: 3.61066 | Sterimol/B3: 3.87444 |
Sterimol/B4: 6.64673 | Sterimol/L: 12.5019 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 453.554 | Positive charged surface: 251.156 | Negative charged surface: 202.398 | Volume: 228 |
Hydrophobic surface: 211.806 | Hydrophilic surface: 241.748 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |