Type: Neutral
Formula: C14H23N2O7P
SMILES: |
P(OCC)(OCC)(=O)C1CC(OC1CO)N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C14H23N2O7P/c1-4-21-24(20,22-5-2)11-6-12(23-10(11)8-17)16-7-9(3)13(18)15-14(16)19/h7,10-12,17H,4-6,8H2,1-3H3,(H,15,18,19)/t10-,11+,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 362.319 g/mol | logS: -1.17071 | SlogP: 0.1138 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.269784 | Sterimol/B1: 2.72336 | Sterimol/B2: 4.11349 | Sterimol/B3: 6.60078 |
Sterimol/B4: 7.31173 | Sterimol/L: 14.836 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 613.059 | Positive charged surface: 421.646 | Negative charged surface: 191.413 | Volume: 316.125 |
Hydrophobic surface: 370.576 | Hydrophilic surface: 242.483 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |