Type: Neutral
Formula: C12H24N4O4
SMILES: |
OC(=O)CC(N)C(=O)NC(NC(=O)N(C(C)(C)C)C)C |
InChI: |
InChI=1/C12H24N4O4/c1-7(14-10(19)8(13)6-9(17)18)15-11(20)16(5)12(2,3)4/h7-8H,6,13H2,1-5H3,(H,14,19)(H,15,20)(H,17,18)/t7-,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.348 g/mol | logS: -0.4296 | SlogP: -0.3095 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.157136 | Sterimol/B1: 1.99366 | Sterimol/B2: 3.64139 | Sterimol/B3: 4.12019 |
Sterimol/B4: 8.4181 | Sterimol/L: 14.3187 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 542.66 | Positive charged surface: 392.638 | Negative charged surface: 150.022 | Volume: 279.5 |
Hydrophobic surface: 281.557 | Hydrophilic surface: 261.103 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |