Type: Neutral
Formula: C12H24N4O4
SMILES: |
OC(=O)CC(N)C(=O)NC(NC(=O)N(C(C)(C)C)C)C |
InChI: |
InChI=1/C12H24N4O4/c1-7(14-10(19)8(13)6-9(17)18)15-11(20)16(5)12(2,3)4/h7-8H,6,13H2,1-5H3,(H,14,19)(H,15,20)(H,17,18)/t7-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.348 g/mol | logS: -0.4296 | SlogP: -0.3095 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0903048 | Sterimol/B1: 1.99046 | Sterimol/B2: 3.04211 | Sterimol/B3: 4.54246 |
Sterimol/B4: 7.40776 | Sterimol/L: 16.2596 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 545.784 | Positive charged surface: 389.683 | Negative charged surface: 156.101 | Volume: 278.5 |
Hydrophobic surface: 284.703 | Hydrophilic surface: 261.081 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |