Type: Neutral
Formula: C14H17N3O3
SMILES: |
OC(=O)C(NC(=O)C(N)C)Cc1c2c([nH]c1)cccc2 |
InChI: |
InChI=1/C14H17N3O3/c1-8(15)13(18)17-12(14(19)20)6-9-7-16-11-5-3-2-4-10(9)11/h2-5,7-8,12,16H,6,15H2,1H3,(H,17,18)(H,19,20)/t8-,12+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 275.308 g/mol | logS: -1.89679 | SlogP: 0.62697 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.196837 | Sterimol/B1: 2.52962 | Sterimol/B2: 2.92473 | Sterimol/B3: 4.24995 |
Sterimol/B4: 7.79518 | Sterimol/L: 11.6444 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 480.469 | Positive charged surface: 304.081 | Negative charged surface: 173.5 | Volume: 262.125 |
Hydrophobic surface: 252.494 | Hydrophilic surface: 227.975 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |