Type: Neutral
Formula: C10H17N2O8P
SMILES: |
P(O)(O)(=O)CC(OC(N1C=C(C)C(=O)NC1=O)CO)CO |
InChI: |
InChI=1/C10H17N2O8P/c1-6-2-12(10(16)11-9(6)15)8(4-14)20-7(3-13)5-21(17,18)19/h2,7-8,13-14H,3-5H2,1H3,(H,11,15,16)(H2,17,18,19)/t7-,8+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 324.226 g/mol | logS: 0.72722 | SlogP: -2.7546 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.177474 | Sterimol/B1: 2.58036 | Sterimol/B2: 5.22638 | Sterimol/B3: 5.31113 |
Sterimol/B4: 5.79077 | Sterimol/L: 12.7822 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 504.643 | Positive charged surface: 336.335 | Negative charged surface: 168.307 | Volume: 259.125 |
Hydrophobic surface: 217.516 | Hydrophilic surface: 287.127 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 6 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |