Type: Neutral
Formula: C11H16N2O7
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(OCC)C(=O)NC1=O |
InChI: |
InChI=1/C11H16N2O7/c1-2-19-5-3-13(11(18)12-9(5)17)10-8(16)7(15)6(4-14)20-10/h3,6-8,10,14-16H,2,4H2,1H3,(H,12,17,18)/t6-,7+,8-,10-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 288.256 g/mol | logS: -0.28527 | SlogP: -2.1449 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0787485 | Sterimol/B1: 3.27928 | Sterimol/B2: 3.38755 | Sterimol/B3: 3.49696 |
Sterimol/B4: 7.57598 | Sterimol/L: 12.3126 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 491.308 | Positive charged surface: 343.454 | Negative charged surface: 147.854 | Volume: 240.375 |
Hydrophobic surface: 212.564 | Hydrophilic surface: 278.744 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |