Type: Neutral
Formula: C10H13N3O7
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C(C(=O)N)C(=O)NC1=O |
InChI: |
InChI=1/C10H13N3O7/c11-7(17)3-1-13(10(19)12-8(3)18)9-6(16)5(15)4(2-14)20-9/h1,4-6,9,14-16H,2H2,(H2,11,17)(H,12,18,19)/t4-,5+,6+,9+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 287.228 g/mol | logS: -0.1598 | SlogP: -3.6536 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0786631 | Sterimol/B1: 2.86418 | Sterimol/B2: 3.89427 | Sterimol/B3: 4.8867 |
Sterimol/B4: 5.16399 | Sterimol/L: 11.7937 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 447.301 | Positive charged surface: 294.325 | Negative charged surface: 152.976 | Volume: 224.375 |
Hydrophobic surface: 104.283 | Hydrophilic surface: 343.018 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |