Type: Ionized
Formula: C6H3O9S3-3
SMILES: |
S(=O)(=O)([O-])c1cc(S(=O)(=O)[O-])cc(S(=O)(=O)[O-])c1 |
InChI: |
InChI=1/C6H6O9S3/c7-16(8,9)4-1-5(17(10,11)12)3-6(2-4)18(13,14)15/h1-3H,(H,7,8,9)(H,10,11,12)(H,13,14,15)/p-3 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 315.279 g/mol | logS: -1.74965 | SlogP: -1.6011 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.100874 | Sterimol/B1: 3.2346 | Sterimol/B2: 3.23733 | Sterimol/B3: 4.76872 |
Sterimol/B4: 5.41528 | Sterimol/L: 10.9353 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 409.716 | Positive charged surface: 46.0321 | Negative charged surface: 363.684 | Volume: 191 |
Hydrophobic surface: 69.1986 | Hydrophilic surface: 340.5174 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 0 | Hydrogen bond acceptors: 0 | Acid groups: 9 | Basic groups: 0 |
Chiral centers: 0 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Parent related molecule:
|