Type: Neutral
Formula: C9H11ClFN3O3
SMILES: |
ClC1=CN(C2OC(CC2F)CO)C(=O)N=C1N |
InChI: |
InChI=1/C9H11ClFN3O3/c10-5-2-14(9(16)13-7(5)12)8-6(11)1-4(3-15)17-8/h2,4,6,8,15H,1,3H2,(H2,12,13,16)/t4-,6-,8-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 263.656 g/mol | logS: -1.83378 | SlogP: 0.8336 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.108352 | Sterimol/B1: 2.67805 | Sterimol/B2: 3.44237 | Sterimol/B3: 4.26837 |
Sterimol/B4: 4.80098 | Sterimol/L: 12.6817 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 426.116 | Positive charged surface: 241.768 | Negative charged surface: 184.347 | Volume: 207.625 |
Hydrophobic surface: 214.755 | Hydrophilic surface: 211.361 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 2 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |