Type: Neutral
Formula: C5H16N2O6P2
SMILES: |
P(O)(O)(=O)C(N)CCCC(P(O)(O)=O)N |
InChI: |
InChI=1/C5H16N2O6P2/c6-4(14(8,9)10)2-1-3-5(7)15(11,12)13/h4-5H,1-3,6-7H2,(H2,8,9,10)(H2,11,12,13)/t4-,5-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 262.139 g/mol | logS: 1.99901 | SlogP: -3.0587 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.155074 | Sterimol/B1: 3.07294 | Sterimol/B2: 3.81141 | Sterimol/B3: 3.84441 |
Sterimol/B4: 4.15099 | Sterimol/L: 11.8303 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 436.04 | Positive charged surface: 285.516 | Negative charged surface: 150.525 | Volume: 202.875 |
Hydrophobic surface: 91.0675 | Hydrophilic surface: 344.9725 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 8 | Hydrogen bond acceptors: 8 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |