Type: Neutral
Formula: C11H17N5O5
SMILES: |
O1C(CO)C(O)C(O)C1N1C=2N=C(NC(=O)C=2N(C1)C)N |
InChI: |
InChI=1/C11H17N5O5/c1-15-3-16(8-5(15)9(20)14-11(12)13-8)10-7(19)6(18)4(2-17)21-10/h4,6-7,10,17-19H,2-3H2,1H3,(H3,12,13,14,20)/t4-,6-,7+,10+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 299.287 g/mol | logS: -0.24883 | SlogP: -3.7561 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0742669 | Sterimol/B1: 2.05611 | Sterimol/B2: 3.41025 | Sterimol/B3: 3.77875 |
Sterimol/B4: 8.46175 | Sterimol/L: 13.0197 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 499.389 | Positive charged surface: 397.583 | Negative charged surface: 101.806 | Volume: 252.875 |
Hydrophobic surface: 193.566 | Hydrophilic surface: 305.823 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 5 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 0 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |