Type: Neutral
Formula: C18H28N4O4
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(C)C)C(=O)NC(C(C)C)C(=O)NN |
InChI: |
InChI=1/C18H28N4O4/c1-11(2)14(16(23)20-15(12(3)4)17(24)22-19)21-18(25)26-10-13-8-6-5-7-9-13/h5-9,11-12,14-15H,10,19H2,1-4H3,(H,20,23)(H,21,25)(H,22,24)/t14-,15+/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 364.446 g/mol | logS: -3.50039 | SlogP: 1.3345 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.135204 | Sterimol/B1: 2.74616 | Sterimol/B2: 3.63271 | Sterimol/B3: 5.65143 |
Sterimol/B4: 8.83258 | Sterimol/L: 15.812 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 659.932 | Positive charged surface: 423.015 | Negative charged surface: 236.917 | Volume: 355.875 |
Hydrophobic surface: 416.829 | Hydrophilic surface: 243.103 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |