Type: Neutral
Formula: C10H12N4O5
SMILES: |
O1C(CO)C(O)C(O)C1N1C=C2N=CNC2=NC1=O |
InChI: |
InChI=1/C10H12N4O5/c15-2-5-6(16)7(17)9(19-5)14-1-4-8(12-3-11-4)13-10(14)18/h1,3,5-7,9,15-17H,2H2,(H,11,12,13,18)/t5-,6+,7-,9-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 268.229 g/mol | logS: -0.55917 | SlogP: -2.2676 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0709422 | Sterimol/B1: 2.9872 | Sterimol/B2: 3.87731 | Sterimol/B3: 3.91265 |
Sterimol/B4: 5.50743 | Sterimol/L: 12.9487 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 441.953 | Positive charged surface: 316.454 | Negative charged surface: 125.499 | Volume: 217.5 |
Hydrophobic surface: 152.543 | Hydrophilic surface: 289.41 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |