Type: Neutral
Formula: C17H19N3O8
SMILES: |
O1C(COC(=O)C)C(OC(=O)C)C(OC(=O)C)C1n1c2N=CNC(=O)c2cc1 |
InChI: |
InChI=1/C17H19N3O8/c1-8(21)25-6-12-13(26-9(2)22)14(27-10(3)23)17(28-12)20-5-4-11-15(20)18-7-19-16(11)24/h4-5,7,12-14,17H,6H2,1-3H3,(H,18,19,24)/t12-,13-,14+,17-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 393.352 g/mol | logS: -2.15502 | SlogP: 0.3107 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.134634 | Sterimol/B1: 2.28819 | Sterimol/B2: 4.0532 | Sterimol/B3: 4.88491 |
Sterimol/B4: 10.0853 | Sterimol/L: 15.4069 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 630.312 | Positive charged surface: 397.427 | Negative charged surface: 232.885 | Volume: 339.375 |
Hydrophobic surface: 397.42 | Hydrophilic surface: 232.892 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |