Type: Neutral
Formula: C11H15N3O6
SMILES: |
O1C(COC(=O)N)C(O)CC1N1C=C(C)C(=O)NC1=O |
InChI: |
InChI=1/C11H15N3O6/c1-5-3-14(11(18)13-9(5)16)8-2-6(15)7(20-8)4-19-10(12)17/h3,6-8,15H,2,4H2,1H3,(H2,12,17)(H,13,16,18)/t6-,7+,8+/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 285.256 g/mol | logS: -0.85083 | SlogP: -0.9868 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0661437 | Sterimol/B1: 2.09178 | Sterimol/B2: 2.60195 | Sterimol/B3: 3.74063 |
Sterimol/B4: 8.42368 | Sterimol/L: 13.922 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 497.597 | Positive charged surface: 330.334 | Negative charged surface: 167.263 | Volume: 240.75 |
Hydrophobic surface: 209.751 | Hydrophilic surface: 287.846 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 3 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |