 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | S(C(C)(C)C)C1C(O)C(OC1N1C=CC(=NC1=O)Nc1ccccc1)CO |
| InChI: | InChI=1/C19H25N3O4S/c1-19(2,3)27-16-15(24)13(11-23)26-17(16)22-10-9-14(21-18(22)25)20-12-7-5-4-6-8-12/h4-10,13,15-17,23-24H,11H2,1-3H3,(H,20,21,25)/t13-,15+,16-,17-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=124.852 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 391.492 g/mol | logS: -3.96633 | SlogP: 2.4247 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0685852 | Sterimol/B1: 2.1911 | Sterimol/B2: 3.49239 | Sterimol/B3: 4.86059 | |||
| Sterimol/B4: 8.88939 | Sterimol/L: 15.8952 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 637.382 | Positive charged surface: 404.427 | Negative charged surface: 232.956 | Volume: 362.875 | |||
| Hydrophobic surface: 435.641 | Hydrophilic surface: 201.741 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 5 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 4 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules: no related molecules available.