 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)CC1NC(=O)C(NC1=O)CCCNC(=[NH2+])N |
| InChI: | InChI=1/C15H21N5O3/c16-15(17)18-7-1-2-11-13(22)20-12(14(23)19-11)8-9-3-5-10(21)6-4-9/h3-6,11-12,21H,1-2,7-8H2,(H,19,23)(H,20,22)(H4,16,17,18)/p+1/t11-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=-0.219529 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 320.373 g/mol | logS: -2.25163 | SlogP: -2.63853 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.0770605 | Sterimol/B1: 3.2516 | Sterimol/B2: 3.38967 | Sterimol/B3: 5.22868 | |||
| Sterimol/B4: 5.81743 | Sterimol/L: 18.1538 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 585.332 | Positive charged surface: 399.741 | Negative charged surface: 185.591 | Volume: 305.625 | |||
| Hydrophobic surface: 263.663 | Hydrophilic surface: 321.669 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 3 | Hydrogen bond acceptors: 3 | Acid groups: 0 | Basic groups: 3 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | ||||
|
