Type: Neutral
Formula: C16H24N2O9
SMILES: |
O(C(=O)C)C1C(NC(=O)C)C(O)C(NC(=O)C)C(OC(=O)C)C1OC(=O)C |
InChI: |
InChI=1/C16H24N2O9/c1-6(19)17-11-13(24)12(18-7(2)20)15(26-9(4)22)16(27-10(5)23)14(11)25-8(3)21/h11-16,24H,1-5H3,(H,17,19)(H,18,20)/t11-,12+,13-,14-,15+,16- |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 388.373 g/mol | logS: -1.14329 | SlogP: -1.8346 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.335734 | Sterimol/B1: 2.16892 | Sterimol/B2: 4.1957 | Sterimol/B3: 5.39091 |
Sterimol/B4: 10.4345 | Sterimol/L: 13.0602 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 604.251 | Positive charged surface: 378.647 | Negative charged surface: 225.604 | Volume: 343.125 |
Hydrophobic surface: 434.201 | Hydrophilic surface: 170.05 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 1 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |