Type: Neutral
Formula: C17H19N2O7P
SMILES: |
P1(OC2CC(OC2CO1)N1C=C(C)C(=O)NC1=O)(OCc1ccccc1)=O |
InChI: |
InChI=1/C17H19N2O7P/c1-11-8-19(17(21)18-16(11)20)15-7-13-14(25-15)10-24-27(22,26-13)23-9-12-5-3-2-4-6-12/h2-6,8,13-15H,7,9-10H2,1H3,(H,18,20,21)/t13-,14-,15-,27-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 394.32 g/mol | logS: -2.89013 | SlogP: 1.4935 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0529591 | Sterimol/B1: 3.30366 | Sterimol/B2: 4.15728 | Sterimol/B3: 4.27106 |
Sterimol/B4: 4.8611 | Sterimol/L: 18.8748 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 614.686 | Positive charged surface: 379.667 | Negative charged surface: 235.018 | Volume: 331.25 |
Hydrophobic surface: 453.109 | Hydrophilic surface: 161.577 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 1 | Hydrogen bond acceptors: 7 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
![](img/zinc.png) |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |