Type: Neutral
Formula: C14H19N3O5
SMILES: |
O(Cc1ccccc1)C(=O)NC(C(O)C)C(=O)NCC(=O)N |
InChI: |
InChI=1/C14H19N3O5/c1-9(18)12(13(20)16-7-11(15)19)17-14(21)22-8-10-5-3-2-4-6-10/h2-6,9,12,18H,7-8H2,1H3,(H2,15,19)(H,16,20)(H,17,21)/t9-,12-/m0/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 309.322 g/mol | logS: -2.18363 | SlogP: -0.4699 | Reactive groups: 0 |
| | | |
Topological Properties | | | |
Globularity: 0.0426548 | Sterimol/B1: 2.49178 | Sterimol/B2: 3.23441 | Sterimol/B3: 3.44095 |
Sterimol/B4: 7.45192 | Sterimol/L: 18.4857 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 575.647 | Positive charged surface: 366.861 | Negative charged surface: 208.786 | Volume: 282.625 |
Hydrophobic surface: 317.175 | Hydrophilic surface: 258.472 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 2 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
|
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |