 |
 |
|
 |
Search | Help | MolPaint | Roadmap | Credits | Feedback |
| SMILES: | Oc1ccc(cc1)C(NC(=O)C(N)CC(C)C)C(=O)N |
| InChI: | InChI=1/C14H21N3O3/c1-8(2)7-11(15)14(20)17-12(13(16)19)9-3-5-10(18)6-4-9/h3-6,8,11-12,18H,7,15H2,1-2H3,(H2,16,19)(H,17,20)/t11-,12-/m0/s1 |
 |
|
| download 2D Mol File
| download 3D Mol File
Potential Energy Epot(MMFF94)=72.5632 kcal/mol |
MOE's Descriptors
| Physical Properties | ||||||
| Molecular Weight: 279.34 g/mol | logS: -2.6984 | SlogP: 0.5037 | Reactive groups: 0 | |||
| Topological Properties | ||||||
| Globularity: 0.115807 | Sterimol/B1: 2.35932 | Sterimol/B2: 4.09944 | Sterimol/B3: 5.01891 | |||
| Sterimol/B4: 5.64493 | Sterimol/L: 14.8748 | |||||
| Surface and Volume Properties | ||||||
| Accessible surface: 531.292 | Positive charged surface: 347.802 | Negative charged surface: 183.49 | Volume: 273.25 | |||
| Hydrophobic surface: 274.413 | Hydrophilic surface: 256.879 | |||||
| Pharmacophoric Properties | ||||||
| Hydrogen bond donors: 4 | Hydrogen bond acceptors: 4 | Acid groups: 0 | Basic groups: 0 | |||
| Chiral centers: 2 | ||||||
| Drug- and Lead-like Properties | ||||||
| Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | ||||
|
Ions/Tautomers related molecules
