Type: Neutral
Formula: C12H13N5O4
SMILES: |
O1C(C2OC2C1n1cc(c2c1ncnc2N)C(=O)N)CO |
InChI: |
InChI=1/C12H13N5O4/c13-9-6-4(10(14)19)1-17(11(6)16-3-15-9)12-8-7(21-8)5(2-18)20-12/h1,3,5,7-8,12,18H,2H2,(H2,14,19)(H2,13,15,16)/t5-,7-,8-,12-/m1/s1 |
MOE's Descriptors
Physical Properties | | | |
Molecular Weight: 291.267 g/mol | logS: -2.25412 | SlogP: -1.135 | Reactive groups: 1 |
| | | |
Topological Properties | | | |
Globularity: 0.0590245 | Sterimol/B1: 3.23189 | Sterimol/B2: 3.33629 | Sterimol/B3: 4.71316 |
Sterimol/B4: 6.30489 | Sterimol/L: 13.7881 | | | |
| | | |
Surface and Volume Properties | | | |
Accessible surface: 489.006 | Positive charged surface: 330.132 | Negative charged surface: 153.663 | Volume: 244.75 |
Hydrophobic surface: 174.231 | Hydrophilic surface: 314.775 | | |
| | | |
Pharmacophoric Properties | | | |
Hydrogen bond donors: 3 | Hydrogen bond acceptors: 6 | Acid groups: 0 | Basic groups: 0 |
Chiral centers: 4 | | | |
| | | |
Drug- and Lead-like Properties | | | |
Lipinski's drug-like rule: 1 | Violations of Lipinski's rule: 0 | Oprea's lead like rule: 1 | |
|
search links for this molecule: |
|
 |
|
|
Ions/Tautomers related molecules: no related molecules available. | | | |